C9H11N5O3 — CID 171384290
2-amino-4-propan-2-yloxy-5,8-dihydropteridine-6,7-dione (PubChem CID 171384290) has the molecular formula C9H11N5O3 and a molecular weight of 237.22 g/mol. Its IUPAC name is 2-amino-4-propan-2-yloxy-5,8-dihydropteridine-6,7-dione.
| Compound Name | 2-amino-4-propan-2-yloxy-5,8-dihydropteridine-6,7-dione |
|---|---|
| PubChem CID | 171384290 |
| Molecular Formula | C9H11N5O3 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 2-amino-4-propan-2-yloxy-5,8-dihydropteridine-6,7-dione |
| SMILES | CC(C)Oc1nc(N)nc2[nH]c(=O)c(=O)[nH]c12 |
| InChI | InChI=1S/C9H11N5O3/c1-3(2)17-8-4-5(13-9(10)14-8)12-7(16)6(15)11-4/h3H,1-2H3,(H,11,15)(H3,10,12,13,14,16) |
| InChIKey | LMTDFXYUZYSPJT-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 126.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|