About 4-(dimethylamino)-N',2-diphenylbutanimidamide
4-(dimethylamino)-N',2-diphenylbutanimidamide (PubChem CID 171384314) has the molecular formula C18H23N3
and a molecular weight of 281.40 g/mol. Its IUPAC name is 4-(dimethylamino)-N',2-diphenylbutanimidamide.
Molecular Properties
| Compound Name | 4-(dimethylamino)-N',2-diphenylbutanimidamide |
| PubChem CID | 171384314 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 4-(dimethylamino)-N',2-diphenylbutanimidamide |
| SMILES | CN(C)CCC(/C(N)=N/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H23N3/c1-21(2)14-13-17(15-9-5-3-6-10-15)18(19)20-16-11-7-4-8-12-16/h3-12,17H,13-14H2,1-2H3,(H2,19,20) |
| InChIKey | XVMXPKVGHMZASQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(dimethylamino)-N',2-diphenylbutanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)-N',2-diphenylbutanimidamide?
The IUPAC name of 4-(dimethylamino)-N',2-diphenylbutanimidamide (CID 171384314) is 4-(dimethylamino)-N',2-diphenylbutanimidamide.
What is the SMILES notation for 4-(dimethylamino)-N',2-diphenylbutanimidamide?
The canonical SMILES for 4-(dimethylamino)-N',2-diphenylbutanimidamide is CN(C)CCC(/C(N)=N/c1ccccc1)c1ccccc1.
What is the InChIKey of 4-(dimethylamino)-N',2-diphenylbutanimidamide?
The InChIKey is XVMXPKVGHMZASQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3/c1-21(2)14-13-17(15-9-5-3-6-10-15)18(19)20-16-11-7-4-8-12-16/h3-12,17H,13-14H2,1-2H3,(H2,19,20).
What are the key properties of 4-(dimethylamino)-N',2-diphenylbutanimidamide?
4-(dimethylamino)-N',2-diphenylbutanimidamide has a molecular weight of 281.40 g/mol, XLogP of 3.41, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)-N',2-diphenylbutanimidamide is sourced from PubChem (CID 171384314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).