About 7-(2-oxopropyl)-7,8-dihydro-5H-pteridin-6-one
7-(2-oxopropyl)-7,8-dihydro-5H-pteridin-6-one (PubChem CID 171384367) has the molecular formula C9H10N4O2
and a molecular weight of 206.21 g/mol. Its IUPAC name is 7-(2-oxopropyl)-7,8-dihydro-5H-pteridin-6-one.
Molecular Properties
| Compound Name | 7-(2-oxopropyl)-7,8-dihydro-5H-pteridin-6-one |
| PubChem CID | 171384367 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 7-(2-oxopropyl)-7,8-dihydro-5H-pteridin-6-one |
| SMILES | CC(=O)CC1Nc2ncncc2NC1=O |
| InChI | InChI=1S/C9H10N4O2/c1-5(14)2-6-9(15)13-7-3-10-4-11-8(7)12-6/h3-4,6H,2H2,1H3,(H,13,15)(H,10,11,12) |
| InChIKey | SUDDXVLHOLYESV-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-(2-oxopropyl)-7,8-dihydro-5H-pteridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-oxopropyl)-7,8-dihydro-5H-pteridin-6-one?
The IUPAC name of 7-(2-oxopropyl)-7,8-dihydro-5H-pteridin-6-one (CID 171384367) is 7-(2-oxopropyl)-7,8-dihydro-5H-pteridin-6-one.
What is the SMILES notation for 7-(2-oxopropyl)-7,8-dihydro-5H-pteridin-6-one?
The canonical SMILES for 7-(2-oxopropyl)-7,8-dihydro-5H-pteridin-6-one is CC(=O)CC1Nc2ncncc2NC1=O.
What is the InChIKey of 7-(2-oxopropyl)-7,8-dihydro-5H-pteridin-6-one?
The InChIKey is SUDDXVLHOLYESV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O2/c1-5(14)2-6-9(15)13-7-3-10-4-11-8(7)12-6/h3-4,6H,2H2,1H3,(H,13,15)(H,10,11,12).
What are the key properties of 7-(2-oxopropyl)-7,8-dihydro-5H-pteridin-6-one?
7-(2-oxopropyl)-7,8-dihydro-5H-pteridin-6-one has a molecular weight of 206.21 g/mol, XLogP of 0.19, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-oxopropyl)-7,8-dihydro-5H-pteridin-6-one is sourced from PubChem (CID 171384367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).