About (tert-butylamino)-(3,4-difluorophenyl)methanol
(tert-butylamino)-(3,4-difluorophenyl)methanol (PubChem CID 171384426) has the molecular formula C11H15F2NO
and a molecular weight of 215.24 g/mol. Its IUPAC name is (tert-butylamino)-(3,4-difluorophenyl)methanol.
Molecular Properties
| Compound Name | (tert-butylamino)-(3,4-difluorophenyl)methanol |
| PubChem CID | 171384426 |
| Molecular Formula | C11H15F2NO |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | (tert-butylamino)-(3,4-difluorophenyl)methanol |
| SMILES | CC(C)(C)NC(O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H15F2NO/c1-11(2,3)14-10(15)7-4-5-8(12)9(13)6-7/h4-6,10,14-15H,1-3H3 |
| InChIKey | SJDGOHYRBOLLKR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (tert-butylamino)-(3,4-difluorophenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (tert-butylamino)-(3,4-difluorophenyl)methanol?
The IUPAC name of (tert-butylamino)-(3,4-difluorophenyl)methanol (CID 171384426) is (tert-butylamino)-(3,4-difluorophenyl)methanol.
What is the SMILES notation for (tert-butylamino)-(3,4-difluorophenyl)methanol?
The canonical SMILES for (tert-butylamino)-(3,4-difluorophenyl)methanol is CC(C)(C)NC(O)c1ccc(F)c(F)c1.
What is the InChIKey of (tert-butylamino)-(3,4-difluorophenyl)methanol?
The InChIKey is SJDGOHYRBOLLKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F2NO/c1-11(2,3)14-10(15)7-4-5-8(12)9(13)6-7/h4-6,10,14-15H,1-3H3.
What are the key properties of (tert-butylamino)-(3,4-difluorophenyl)methanol?
(tert-butylamino)-(3,4-difluorophenyl)methanol has a molecular weight of 215.24 g/mol, XLogP of 2.34, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (tert-butylamino)-(3,4-difluorophenyl)methanol is sourced from PubChem (CID 171384426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).