About 2-(2,4-dinitrophenyl)-5-methyl-3,4-dihydropyrazole
2-(2,4-dinitrophenyl)-5-methyl-3,4-dihydropyrazole (PubChem CID 171384457) has the molecular formula C10H10N4O4
and a molecular weight of 250.21 g/mol. Its IUPAC name is 2-(2,4-dinitrophenyl)-5-methyl-3,4-dihydropyrazole.
Molecular Properties
| Compound Name | 2-(2,4-dinitrophenyl)-5-methyl-3,4-dihydropyrazole |
| PubChem CID | 171384457 |
| Molecular Formula | C10H10N4O4 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 2-(2,4-dinitrophenyl)-5-methyl-3,4-dihydropyrazole |
| SMILES | CC1=NN(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C10H10N4O4/c1-7-4-5-12(11-7)9-3-2-8(13(15)16)6-10(9)14(17)18/h2-3,6H,4-5H2,1H3 |
| InChIKey | BXKCRRUJYRPBDH-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 101.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-dinitrophenyl)-5-methyl-3,4-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dinitrophenyl)-5-methyl-3,4-dihydropyrazole?
The IUPAC name of 2-(2,4-dinitrophenyl)-5-methyl-3,4-dihydropyrazole (CID 171384457) is 2-(2,4-dinitrophenyl)-5-methyl-3,4-dihydropyrazole.
What is the SMILES notation for 2-(2,4-dinitrophenyl)-5-methyl-3,4-dihydropyrazole?
The canonical SMILES for 2-(2,4-dinitrophenyl)-5-methyl-3,4-dihydropyrazole is CC1=NN(c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])CC1.
What is the InChIKey of 2-(2,4-dinitrophenyl)-5-methyl-3,4-dihydropyrazole?
The InChIKey is BXKCRRUJYRPBDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4O4/c1-7-4-5-12(11-7)9-3-2-8(13(15)16)6-10(9)14(17)18/h2-3,6H,4-5H2,1H3.
What are the key properties of 2-(2,4-dinitrophenyl)-5-methyl-3,4-dihydropyrazole?
2-(2,4-dinitrophenyl)-5-methyl-3,4-dihydropyrazole has a molecular weight of 250.21 g/mol, XLogP of 2.09, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dinitrophenyl)-5-methyl-3,4-dihydropyrazole is sourced from PubChem (CID 171384457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).