About 4-(2,5-dimethylpyrrol-1-yl)-3,5-dimethylphenol
4-(2,5-dimethylpyrrol-1-yl)-3,5-dimethylphenol (PubChem CID 171384576) has the molecular formula C14H17NO
and a molecular weight of 215.30 g/mol. Its IUPAC name is 4-(2,5-dimethylpyrrol-1-yl)-3,5-dimethylphenol.
Molecular Properties
| Compound Name | 4-(2,5-dimethylpyrrol-1-yl)-3,5-dimethylphenol |
| PubChem CID | 171384576 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 4-(2,5-dimethylpyrrol-1-yl)-3,5-dimethylphenol |
| SMILES | Cc1cc(O)cc(C)c1-n1c(C)ccc1C |
| InChI | InChI=1S/C14H17NO/c1-9-7-13(16)8-10(2)14(9)15-11(3)5-6-12(15)4/h5-8,16H,1-4H3 |
| InChIKey | SSHNSPRQVLTOCV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,5-dimethylpyrrol-1-yl)-3,5-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,5-dimethylpyrrol-1-yl)-3,5-dimethylphenol?
The IUPAC name of 4-(2,5-dimethylpyrrol-1-yl)-3,5-dimethylphenol (CID 171384576) is 4-(2,5-dimethylpyrrol-1-yl)-3,5-dimethylphenol.
What is the SMILES notation for 4-(2,5-dimethylpyrrol-1-yl)-3,5-dimethylphenol?
The canonical SMILES for 4-(2,5-dimethylpyrrol-1-yl)-3,5-dimethylphenol is Cc1cc(O)cc(C)c1-n1c(C)ccc1C.
What is the InChIKey of 4-(2,5-dimethylpyrrol-1-yl)-3,5-dimethylphenol?
The InChIKey is SSHNSPRQVLTOCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17NO/c1-9-7-13(16)8-10(2)14(9)15-11(3)5-6-12(15)4/h5-8,16H,1-4H3.
What are the key properties of 4-(2,5-dimethylpyrrol-1-yl)-3,5-dimethylphenol?
4-(2,5-dimethylpyrrol-1-yl)-3,5-dimethylphenol has a molecular weight of 215.30 g/mol, XLogP of 3.42, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dimethylpyrrol-1-yl)-3,5-dimethylphenol is sourced from PubChem (CID 171384576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).