C10H9N5O6 — CID 171384625
5-methyl-2-(2,4,6-trinitrophenyl)-3,4-dihydropyrazole (PubChem CID 171384625) has the molecular formula C10H9N5O6 and a molecular weight of 295.21 g/mol. Its IUPAC name is 5-methyl-2-(2,4,6-trinitrophenyl)-3,4-dihydropyrazole.
| Compound Name | 5-methyl-2-(2,4,6-trinitrophenyl)-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 171384625 |
| Molecular Formula | C10H9N5O6 |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 5-methyl-2-(2,4,6-trinitrophenyl)-3,4-dihydropyrazole |
| SMILES | CC1=NN(c2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C10H9N5O6/c1-6-2-3-12(11-6)10-8(14(18)19)4-7(13(16)17)5-9(10)15(20)21/h4-5H,2-3H2,1H3 |
| InChIKey | GIDVGARMEUWQCV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 145.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|