C13H13N — CID 171384652
N,N-dimethyl-5-phenylpenta-2,4-diyn-1-amine (PubChem CID 171384652) has the molecular formula C13H13N and a molecular weight of 183.25 g/mol. Its IUPAC name is N,N-dimethyl-5-phenylpenta-2,4-diyn-1-amine.
| Compound Name | N,N-dimethyl-5-phenylpenta-2,4-diyn-1-amine |
|---|---|
| PubChem CID | 171384652 |
| Molecular Formula | C13H13N |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | N,N-dimethyl-5-phenylpenta-2,4-diyn-1-amine |
| SMILES | CN(C)CC#CC#Cc1ccccc1 |
| InChI | InChI=1S/C13H13N/c1-14(2)12-8-4-7-11-13-9-5-3-6-10-13/h3,5-6,9-10H,12H2,1-2H3 |
| InChIKey | YPQIERQENFZEJN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|