C21H22N4O2 — CID 171384687
1-[[5-(1-methylpiperidin-2-yl)-2-pyridinyl]diazenyl]naphthalene-2,7-diol (PubChem CID 171384687) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is 1-[[5-(1-methylpiperidin-2-yl)-2-pyridinyl]diazenyl]naphthalene-2,7-diol.
| Compound Name | 1-[[5-(1-methylpiperidin-2-yl)-2-pyridinyl]diazenyl]naphthalene-2,7-diol |
|---|---|
| PubChem CID | 171384687 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 1-[[5-(1-methylpiperidin-2-yl)-2-pyridinyl]diazenyl]naphthalene-2,7-diol |
| SMILES | CN1CCCCC1c1ccc(/N=N/c2c(O)ccc3ccc(O)cc23)nc1 |
| InChI | InChI=1S/C21H22N4O2/c1-25-11-3-2-4-18(25)15-7-10-20(22-13-15)23-24-21-17-12-16(26)8-5-14(17)6-9-19(21)27/h5-10,12-13,18,26-27H,2-4,11H2,1H3/b24-23+ |
| InChIKey | PHPZXKMLZVNFDB-WCWDXBQESA-N |
| XLogP | 5.22 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|