About 5-methyl-2,3,4,8-tetrahydropyrano[2,3-b]pyridin-7-one
5-methyl-2,3,4,8-tetrahydropyrano[2,3-b]pyridin-7-one (PubChem CID 171384690) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 5-methyl-2,3,4,8-tetrahydropyrano[2,3-b]pyridin-7-one.
Analyze 5-methyl-2,3,4,8-tetrahydropyrano[2,3-b]pyridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2,3,4,8-tetrahydropyrano[2,3-b]pyridin-7-one?
The IUPAC name of 5-methyl-2,3,4,8-tetrahydropyrano[2,3-b]pyridin-7-one (CID 171384690) is 5-methyl-2,3,4,8-tetrahydropyrano[2,3-b]pyridin-7-one.
What is the SMILES notation for 5-methyl-2,3,4,8-tetrahydropyrano[2,3-b]pyridin-7-one?
The canonical SMILES for 5-methyl-2,3,4,8-tetrahydropyrano[2,3-b]pyridin-7-one is Cc1cc(=O)[nH]c2c1CCCO2.
What is the InChIKey of 5-methyl-2,3,4,8-tetrahydropyrano[2,3-b]pyridin-7-one?
The InChIKey is KJXZKCSUPWDUPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-6-5-8(11)10-9-7(6)3-2-4-12-9/h5H,2-4H2,1H3,(H,10,11).
What are the key properties of 5-methyl-2,3,4,8-tetrahydropyrano[2,3-b]pyridin-7-one?
5-methyl-2,3,4,8-tetrahydropyrano[2,3-b]pyridin-7-one has a molecular weight of 165.19 g/mol, XLogP of 1.01, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2,3,4,8-tetrahydropyrano[2,3-b]pyridin-7-one is sourced from PubChem (CID 171384690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).