C14H15N — CID 171384697
N,N-dimethyl-5-(4-methylphenyl)penta-2,4-diyn-1-amine (PubChem CID 171384697) has the molecular formula C14H15N and a molecular weight of 197.28 g/mol. Its IUPAC name is N,N-dimethyl-5-(4-methylphenyl)penta-2,4-diyn-1-amine.
| Compound Name | N,N-dimethyl-5-(4-methylphenyl)penta-2,4-diyn-1-amine |
|---|---|
| PubChem CID | 171384697 |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | N,N-dimethyl-5-(4-methylphenyl)penta-2,4-diyn-1-amine |
| SMILES | Cc1ccc(C#CC#CCN(C)C)cc1 |
| InChI | InChI=1S/C14H15N/c1-13-8-10-14(11-9-13)7-5-4-6-12-15(2)3/h8-11H,12H2,1-3H3 |
| InChIKey | GLCTWMXCGQVWMH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|