About 8-ethyl-2-(ethylamino)-5,6-dihydropteridin-7-one
8-ethyl-2-(ethylamino)-5,6-dihydropteridin-7-one (PubChem CID 171384841) has the molecular formula C10H15N5O
and a molecular weight of 221.26 g/mol. Its IUPAC name is 8-ethyl-2-(ethylamino)-5,6-dihydropteridin-7-one.
Molecular Properties
| Compound Name | 8-ethyl-2-(ethylamino)-5,6-dihydropteridin-7-one |
| PubChem CID | 171384841 |
| Molecular Formula | C10H15N5O |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 8-ethyl-2-(ethylamino)-5,6-dihydropteridin-7-one |
| SMILES | CCNc1ncc2c(n1)N(CC)C(=O)CN2 |
| InChI | InChI=1S/C10H15N5O/c1-3-11-10-13-5-7-9(14-10)15(4-2)8(16)6-12-7/h5,12H,3-4,6H2,1-2H3,(H,11,13,14) |
| InChIKey | UKVQRZYCQOVJPN-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-ethyl-2-(ethylamino)-5,6-dihydropteridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethyl-2-(ethylamino)-5,6-dihydropteridin-7-one?
The IUPAC name of 8-ethyl-2-(ethylamino)-5,6-dihydropteridin-7-one (CID 171384841) is 8-ethyl-2-(ethylamino)-5,6-dihydropteridin-7-one.
What is the SMILES notation for 8-ethyl-2-(ethylamino)-5,6-dihydropteridin-7-one?
The canonical SMILES for 8-ethyl-2-(ethylamino)-5,6-dihydropteridin-7-one is CCNc1ncc2c(n1)N(CC)C(=O)CN2.
What is the InChIKey of 8-ethyl-2-(ethylamino)-5,6-dihydropteridin-7-one?
The InChIKey is UKVQRZYCQOVJPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N5O/c1-3-11-10-13-5-7-9(14-10)15(4-2)8(16)6-12-7/h5,12H,3-4,6H2,1-2H3,(H,11,13,14).
What are the key properties of 8-ethyl-2-(ethylamino)-5,6-dihydropteridin-7-one?
8-ethyl-2-(ethylamino)-5,6-dihydropteridin-7-one has a molecular weight of 221.26 g/mol, XLogP of 0.69, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethyl-2-(ethylamino)-5,6-dihydropteridin-7-one is sourced from PubChem (CID 171384841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).