C9H13N5O2 — CID 171384871
2-amino-3,7,7-trimethyl-5,8-dihydropteridine-4,6-dione (PubChem CID 171384871) has the molecular formula C9H13N5O2 and a molecular weight of 223.24 g/mol. Its IUPAC name is 2-amino-3,7,7-trimethyl-5,8-dihydropteridine-4,6-dione.
| Compound Name | 2-amino-3,7,7-trimethyl-5,8-dihydropteridine-4,6-dione |
|---|---|
| PubChem CID | 171384871 |
| Molecular Formula | C9H13N5O2 |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 2-amino-3,7,7-trimethyl-5,8-dihydropteridine-4,6-dione |
| SMILES | Cn1c(N)nc2c(c1=O)NC(=O)C(C)(C)N2 |
| InChI | InChI=1S/C9H13N5O2/c1-9(2)7(16)11-4-5(13-9)12-8(10)14(3)6(4)15/h13H,1-3H3,(H2,10,12)(H,11,16) |
| InChIKey | BGQNCELTRCRQHE-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |