C7H7I2NS — CID 171384885
3,5-diiodo-4-methylsulfanylaniline (PubChem CID 171384885) has the molecular formula C7H7I2NS and a molecular weight of 391.02 g/mol. Its IUPAC name is 3,5-diiodo-4-methylsulfanylaniline.
| Compound Name | 3,5-diiodo-4-methylsulfanylaniline |
|---|---|
| PubChem CID | 171384885 |
| Molecular Formula | C7H7I2NS |
| Molecular Weight | 391.02 g/mol |
| Exact Mass | 390.84 |
| IUPAC Name | 3,5-diiodo-4-methylsulfanylaniline |
| SMILES | CSc1c(I)cc(N)cc1I |
| InChI | InChI=1S/C7H7I2NS/c1-11-7-5(8)2-4(10)3-6(7)9/h2-3H,10H2,1H3 |
| InChIKey | PTEBHGKNIMBJFJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.02 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|