C20H25N5O2S — CID 171385235
(1R,2S,8R,9S)-11-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecane-8-carboxamide (PubChem CID 171385235) has the molecular formula C20H25N5O2S and a molecular weight of 399.52 g/mol. Its IUPAC name is (1R,2S,8R,9S)-11-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecane-8-carboxamide.
| Compound Name | (1R,2S,8R,9S)-11-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecane-8-carboxamide |
|---|---|
| PubChem CID | 171385235 |
| Molecular Formula | C20H25N5O2S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | (1R,2S,8R,9S)-11-(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]tridecane-8-carboxamide |
| SMILES | Cc1sc2ncnc(N3C[C@H]4C[C@@H](C3)[C@H](C(N)=O)N3C(=O)CCC[C@@H]43)c2c1C |
| InChI | InChI=1S/C20H25N5O2S/c1-10-11(2)28-20-16(10)19(22-9-23-20)24-7-12-6-13(8-24)17(18(21)27)25-14(12)4-3-5-15(25)26/h9,12-14,17H,3-8H2,1-2H3,(H2,21,27)/t12-,13+,14+,17-/m1/s1 |
| InChIKey | XBGXZJXIXFLBGK-XJIUQZFPSA-N |
| XLogP | 2.00 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |