C25H29N5O2 — CID 171386003
(1R,2S,8R,9S)-8-(1,3-dihydroisoindole-2-carbonyl)-11-(2-methylpyrimidin-4-yl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 171386003) has the molecular formula C25H29N5O2 and a molecular weight of 431.54 g/mol. Its IUPAC name is (1R,2S,8R,9S)-8-(1,3-dihydroisoindole-2-carbonyl)-11-(2-methylpyrimidin-4-yl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8R,9S)-8-(1,3-dihydroisoindole-2-carbonyl)-11-(2-methylpyrimidin-4-yl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 171386003 |
| Molecular Formula | C25H29N5O2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | (1R,2S,8R,9S)-8-(1,3-dihydroisoindole-2-carbonyl)-11-(2-methylpyrimidin-4-yl)-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | Cc1nccc(N2C[C@H]3C[C@@H](C2)[C@H](C(=O)N2Cc4ccccc4C2)N2C(=O)CCC[C@@H]32)n1 |
| InChI | InChI=1S/C25H29N5O2/c1-16-26-10-9-22(27-16)28-14-19-11-20(15-28)24(30-21(19)7-4-8-23(30)31)25(32)29-12-17-5-2-3-6-18(17)13-29/h2-3,5-6,9-10,19-21,24H,4,7-8,11-15H2,1H3/t19-,20+,21+,24-/m1/s1 |
| InChIKey | SHPVHTAYTJGILK-MDAIXWLXSA-N |
| XLogP | 2.53 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |