C19H25N5O2S — CID 171386707
(3aR,4S,6aS)-N,N-dimethyl-4-(2-methylphenyl)-2-pyrazin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-sulfonamide (PubChem CID 171386707) has the molecular formula C19H25N5O2S and a molecular weight of 387.51 g/mol. Its IUPAC name is (3aR,4S,6aS)-N,N-dimethyl-4-(2-methylphenyl)-2-pyrazin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-sulfonamide.
| Compound Name | (3aR,4S,6aS)-N,N-dimethyl-4-(2-methylphenyl)-2-pyrazin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-sulfonamide |
|---|---|
| PubChem CID | 171386707 |
| Molecular Formula | C19H25N5O2S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | (3aR,4S,6aS)-N,N-dimethyl-4-(2-methylphenyl)-2-pyrazin-2-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-sulfonamide |
| SMILES | Cc1ccccc1[C@@H]1[C@H]2CN(c3cnccn3)C[C@H]2CN1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C19H25N5O2S/c1-14-6-4-5-7-16(14)19-17-13-23(18-10-20-8-9-21-18)11-15(17)12-24(19)27(25,26)22(2)3/h4-10,15,17,19H,11-13H2,1-3H3/t15-,17-,19+/m0/s1 |
| InChIKey | ODVULXZKGJOCPV-VDZJLULYSA-N |
| XLogP | 1.70 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |