C24H24N2O4 — CID 171387353
N-[4-(2-amino-2-oxoethyl)phenyl]-4-methyl-2-oxo-6-(3-phenylpropyl)pyran-3-carboxamide (PubChem CID 171387353) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is N-[4-(2-amino-2-oxoethyl)phenyl]-4-methyl-2-oxo-6-(3-phenylpropyl)pyran-3-carboxamide.
| Compound Name | N-[4-(2-amino-2-oxoethyl)phenyl]-4-methyl-2-oxo-6-(3-phenylpropyl)pyran-3-carboxamide |
|---|---|
| PubChem CID | 171387353 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | N-[4-(2-amino-2-oxoethyl)phenyl]-4-methyl-2-oxo-6-(3-phenylpropyl)pyran-3-carboxamide |
| SMILES | Cc1cc(CCCc2ccccc2)oc(=O)c1C(=O)Nc1ccc(CC(N)=O)cc1 |
| InChI | InChI=1S/C24H24N2O4/c1-16-14-20(9-5-8-17-6-3-2-4-7-17)30-24(29)22(16)23(28)26-19-12-10-18(11-13-19)15-21(25)27/h2-4,6-7,10-14H,5,8-9,15H2,1H3,(H2,25,27)(H,26,28) |
| InChIKey | HJQXOEULPGEGSL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |