C17H25N5O — CID 171387553
2-amino-4-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]-6,7-dihydro-5H-pyrido[3,4-d]pyrimidin-8-one (PubChem CID 171387553) has the molecular formula C17H25N5O and a molecular weight of 315.42 g/mol. Its IUPAC name is 2-amino-4-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]-6,7-dihydro-5H-pyrido[3,4-d]pyrimidin-8-one.
| Compound Name | 2-amino-4-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]-6,7-dihydro-5H-pyrido[3,4-d]pyrimidin-8-one |
|---|---|
| PubChem CID | 171387553 |
| Molecular Formula | C17H25N5O |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | 2-amino-4-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]-6,7-dihydro-5H-pyrido[3,4-d]pyrimidin-8-one |
| SMILES | CC1(C)C[C@@H]2C[C@@](C)(CN2c2nc(N)nc3c2CCNC3=O)C1 |
| InChI | InChI=1S/C17H25N5O/c1-16(2)6-10-7-17(3,8-16)9-22(10)13-11-4-5-19-14(23)12(11)20-15(18)21-13/h10H,4-9H2,1-3H3,(H,19,23)(H2,18,20,21)/t10-,17-/m1/s1 |
| InChIKey | HWNRLDYAYHPIAK-BMLIUANNSA-N |
| XLogP | 1.75 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |