C21H30N2O2S2 — CID 171387617
(3aR,4S,6aS)-5-(cyclopropylmethylsulfonyl)-4-phenyl-2-(thian-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 171387617) has the molecular formula C21H30N2O2S2 and a molecular weight of 406.62 g/mol. Its IUPAC name is (3aR,4S,6aS)-5-(cyclopropylmethylsulfonyl)-4-phenyl-2-(thian-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | (3aR,4S,6aS)-5-(cyclopropylmethylsulfonyl)-4-phenyl-2-(thian-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 171387617 |
| Molecular Formula | C21H30N2O2S2 |
| Molecular Weight | 406.62 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | (3aR,4S,6aS)-5-(cyclopropylmethylsulfonyl)-4-phenyl-2-(thian-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | O=S(=O)(CC1CC1)N1C[C@@H]2CN(C3CCSCC3)C[C@@H]2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H30N2O2S2/c24-27(25,15-16-6-7-16)23-13-18-12-22(19-8-10-26-11-9-19)14-20(18)21(23)17-4-2-1-3-5-17/h1-5,16,18-21H,6-15H2/t18-,20-,21+/m0/s1 |
| InChIKey | PTKFFBHDAPVUGM-SESVDKBCSA-N |
| XLogP | 3.23 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.62 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |