C21H18ClN3O4 — CID 171387881
6-chloro-2-oxo-N-[[(2S)-5-oxopyrrolidin-2-yl]methyl]-N-(pyridin-2-ylmethyl)chromene-3-carboxamide (PubChem CID 171387881) has the molecular formula C21H18ClN3O4 and a molecular weight of 411.85 g/mol. Its IUPAC name is 6-chloro-2-oxo-N-[[(2S)-5-oxopyrrolidin-2-yl]methyl]-N-(pyridin-2-ylmethyl)chromene-3-carboxamide.
| Compound Name | 6-chloro-2-oxo-N-[[(2S)-5-oxopyrrolidin-2-yl]methyl]-N-(pyridin-2-ylmethyl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 171387881 |
| Molecular Formula | C21H18ClN3O4 |
| Molecular Weight | 411.85 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | 6-chloro-2-oxo-N-[[(2S)-5-oxopyrrolidin-2-yl]methyl]-N-(pyridin-2-ylmethyl)chromene-3-carboxamide |
| SMILES | O=C1CC[C@@H](CN(Cc2ccccn2)C(=O)c2cc3cc(Cl)ccc3oc2=O)N1 |
| InChI | InChI=1S/C21H18ClN3O4/c22-14-4-6-18-13(9-14)10-17(21(28)29-18)20(27)25(11-15-3-1-2-8-23-15)12-16-5-7-19(26)24-16/h1-4,6,8-10,16H,5,7,11-12H2,(H,24,26)/t16-/m0/s1 |
| InChIKey | YUHJMUVRIJCXRJ-INIZCTEOSA-N |
| XLogP | 2.76 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.85 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|