C21H25FN4O3 — CID 171388820
1-[(3aR,4S,6aS)-4-(3-fluorophenyl)-2-(1-methylimidazole-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-ethoxyethanone (PubChem CID 171388820) has the molecular formula C21H25FN4O3 and a molecular weight of 400.45 g/mol. Its IUPAC name is 1-[(3aR,4S,6aS)-4-(3-fluorophenyl)-2-(1-methylimidazole-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-ethoxyethanone.
| Compound Name | 1-[(3aR,4S,6aS)-4-(3-fluorophenyl)-2-(1-methylimidazole-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-ethoxyethanone |
|---|---|
| PubChem CID | 171388820 |
| Molecular Formula | C21H25FN4O3 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 1-[(3aR,4S,6aS)-4-(3-fluorophenyl)-2-(1-methylimidazole-2-carbonyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-ethoxyethanone |
| SMILES | CCOCC(=O)N1C[C@@H]2CN(C(=O)c3nccn3C)C[C@@H]2[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C21H25FN4O3/c1-3-29-13-18(27)26-11-15-10-25(21(28)20-23-7-8-24(20)2)12-17(15)19(26)14-5-4-6-16(22)9-14/h4-9,15,17,19H,3,10-13H2,1-2H3/t15-,17-,19+/m0/s1 |
| InChIKey | RGBKKWLQRVXUOV-VDZJLULYSA-N |
| XLogP | 1.87 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |