About 4-(2-chloro-5-fluorophenyl)-7-(dimethylsulfamoylamino)-2-oxo-3,4-dihydro-1H-quinoline
4-(2-chloro-5-fluorophenyl)-7-(dimethylsulfamoylamino)-2-oxo-3,4-dihydro-1H-quinoline (PubChem CID 171388900) has the molecular formula C17H17ClFN3O3S
and a molecular weight of 397.86 g/mol. Its IUPAC name is 4-(2-chloro-5-fluorophenyl)-7-(dimethylsulfamoylamino)-2-oxo-3,4-dihydro-1H-quinoline.
Molecular Properties
| Compound Name | 4-(2-chloro-5-fluorophenyl)-7-(dimethylsulfamoylamino)-2-oxo-3,4-dihydro-1H-quinoline |
| PubChem CID | 171388900 |
| Molecular Formula | C17H17ClFN3O3S |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 4-(2-chloro-5-fluorophenyl)-7-(dimethylsulfamoylamino)-2-oxo-3,4-dihydro-1H-quinoline |
| SMILES | CN(C)S(=O)(=O)Nc1ccc2c(c1)NC(=O)CC2c1cc(F)ccc1Cl |
| InChI | InChI=1S/C17H17ClFN3O3S/c1-22(2)26(24,25)21-11-4-5-12-13(9-17(23)20-16(12)8-11)14-7-10(19)3-6-15(14)18/h3-8,13,21H,9H2,1-2H3,(H,20,23) |
| InChIKey | OMHCISJMTMTCAI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-chloro-5-fluorophenyl)-7-(dimethylsulfamoylamino)-2-oxo-3,4-dihydro-1H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chloro-5-fluorophenyl)-7-(dimethylsulfamoylamino)-2-oxo-3,4-dihydro-1H-quinoline?
The IUPAC name of 4-(2-chloro-5-fluorophenyl)-7-(dimethylsulfamoylamino)-2-oxo-3,4-dihydro-1H-quinoline (CID 171388900) is 4-(2-chloro-5-fluorophenyl)-7-(dimethylsulfamoylamino)-2-oxo-3,4-dihydro-1H-quinoline.
What is the SMILES notation for 4-(2-chloro-5-fluorophenyl)-7-(dimethylsulfamoylamino)-2-oxo-3,4-dihydro-1H-quinoline?
The canonical SMILES for 4-(2-chloro-5-fluorophenyl)-7-(dimethylsulfamoylamino)-2-oxo-3,4-dihydro-1H-quinoline is CN(C)S(=O)(=O)Nc1ccc2c(c1)NC(=O)CC2c1cc(F)ccc1Cl.
What is the InChIKey of 4-(2-chloro-5-fluorophenyl)-7-(dimethylsulfamoylamino)-2-oxo-3,4-dihydro-1H-quinoline?
The InChIKey is OMHCISJMTMTCAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17ClFN3O3S/c1-22(2)26(24,25)21-11-4-5-12-13(9-17(23)20-16(12)8-11)14-7-10(19)3-6-15(14)18/h3-8,13,21H,9H2,1-2H3,(H,20,23).
What are the key properties of 4-(2-chloro-5-fluorophenyl)-7-(dimethylsulfamoylamino)-2-oxo-3,4-dihydro-1H-quinoline?
4-(2-chloro-5-fluorophenyl)-7-(dimethylsulfamoylamino)-2-oxo-3,4-dihydro-1H-quinoline has a molecular weight of 397.86 g/mol, XLogP of 3.17, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chloro-5-fluorophenyl)-7-(dimethylsulfamoylamino)-2-oxo-3,4-dihydro-1H-quinoline is sourced from PubChem (CID 171388900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).