C24H30N2O5 — CID 171389319
6,7-dimethoxy-4-[3-(3-morpholin-4-ylpropoxy)phenyl]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 171389319) has the molecular formula C24H30N2O5 and a molecular weight of 426.51 g/mol. Its IUPAC name is 6,7-dimethoxy-4-[3-(3-morpholin-4-ylpropoxy)phenyl]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 6,7-dimethoxy-4-[3-(3-morpholin-4-ylpropoxy)phenyl]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 171389319 |
| Molecular Formula | C24H30N2O5 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 6,7-dimethoxy-4-[3-(3-morpholin-4-ylpropoxy)phenyl]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | COc1cc2c(cc1OC)C(c1cccc(OCCCN3CCOCC3)c1)CC(=O)N2 |
| InChI | InChI=1S/C24H30N2O5/c1-28-22-14-20-19(15-24(27)25-21(20)16-23(22)29-2)17-5-3-6-18(13-17)31-10-4-7-26-8-11-30-12-9-26/h3,5-6,13-14,16,19H,4,7-12,15H2,1-2H3,(H,25,27) |
| InChIKey | ASAREBQPORDOJV-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|