C22H32N6O2 — CID 171389549
(1R,2S,8R,9S)-8-[[(8-oxo-2-propan-2-yl-6,7-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl)amino]methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 171389549) has the molecular formula C22H32N6O2 and a molecular weight of 412.54 g/mol. Its IUPAC name is (1R,2S,8R,9S)-8-[[(8-oxo-2-propan-2-yl-6,7-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl)amino]methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1R,2S,8R,9S)-8-[[(8-oxo-2-propan-2-yl-6,7-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl)amino]methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 171389549 |
| Molecular Formula | C22H32N6O2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | (1R,2S,8R,9S)-8-[[(8-oxo-2-propan-2-yl-6,7-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl)amino]methyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | CC(C)c1nc(NC[C@H]2[C@@H]3CNC[C@@H](C3)[C@@H]3CCCC(=O)N32)c2c(n1)C(=O)NCC2 |
| InChI | InChI=1S/C22H32N6O2/c1-12(2)20-26-19-15(6-7-24-22(19)30)21(27-20)25-11-17-14-8-13(9-23-10-14)16-4-3-5-18(29)28(16)17/h12-14,16-17,23H,3-11H2,1-2H3,(H,24,30)(H,25,26,27)/t13-,14+,16+,17+/m1/s1 |
| InChIKey | FTJCZXQRWDFOGA-OHFALNGGSA-N |
| XLogP | 1.29 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |