About 2-(18F)fluoroethyl 3-[(1R)-1-(4-chlorophenyl)ethyl]imidazole-4-carboxylate
2-(18F)fluoroethyl 3-[(1R)-1-(4-chlorophenyl)ethyl]imidazole-4-carboxylate (PubChem CID 171390277) has the molecular formula C14H14ClFN2O2
and a molecular weight of 295.73 g/mol. Its IUPAC name is 2-(18F)fluoroethyl 3-[(1R)-1-(4-chlorophenyl)ethyl]imidazole-4-carboxylate.
Molecular Properties
| Compound Name | 2-(18F)fluoroethyl 3-[(1R)-1-(4-chlorophenyl)ethyl]imidazole-4-carboxylate |
| PubChem CID | 171390277 |
| Molecular Formula | C14H14ClFN2O2 |
| Molecular Weight | 295.73 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 2-(18F)fluoroethyl 3-[(1R)-1-(4-chlorophenyl)ethyl]imidazole-4-carboxylate |
| SMILES | C[C@H](c1ccc(Cl)cc1)n1cncc1C(=O)OCC[18F] |
| InChI | InChI=1S/C14H14ClFN2O2/c1-10(11-2-4-12(15)5-3-11)18-9-17-8-13(18)14(19)20-7-6-16/h2-5,8-10H,6-7H2,1H3/t10-/m1/s1/i16-1 |
| InChIKey | LLQSQLUUPNLKRG-CNVZLFMUSA-N |
| XLogP | 3.27 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.73 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(18F)fluoroethyl 3-[(1R)-1-(4-chlorophenyl)ethyl]imidazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(18F)fluoroethyl 3-[(1R)-1-(4-chlorophenyl)ethyl]imidazole-4-carboxylate?
The IUPAC name of 2-(18F)fluoroethyl 3-[(1R)-1-(4-chlorophenyl)ethyl]imidazole-4-carboxylate (CID 171390277) is 2-(18F)fluoroethyl 3-[(1R)-1-(4-chlorophenyl)ethyl]imidazole-4-carboxylate.
What is the SMILES notation for 2-(18F)fluoroethyl 3-[(1R)-1-(4-chlorophenyl)ethyl]imidazole-4-carboxylate?
The canonical SMILES for 2-(18F)fluoroethyl 3-[(1R)-1-(4-chlorophenyl)ethyl]imidazole-4-carboxylate is C[C@H](c1ccc(Cl)cc1)n1cncc1C(=O)OCC[18F].
What is the InChIKey of 2-(18F)fluoroethyl 3-[(1R)-1-(4-chlorophenyl)ethyl]imidazole-4-carboxylate?
The InChIKey is LLQSQLUUPNLKRG-CNVZLFMUSA-N. The full InChI is InChI=1S/C14H14ClFN2O2/c1-10(11-2-4-12(15)5-3-11)18-9-17-8-13(18)14(19)20-7-6-16/h2-5,8-10H,6-7H2,1H3/t10-/m1/s1/i16-1.
What are the key properties of 2-(18F)fluoroethyl 3-[(1R)-1-(4-chlorophenyl)ethyl]imidazole-4-carboxylate?
2-(18F)fluoroethyl 3-[(1R)-1-(4-chlorophenyl)ethyl]imidazole-4-carboxylate has a molecular weight of 295.73 g/mol, XLogP of 3.27, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(18F)fluoroethyl 3-[(1R)-1-(4-chlorophenyl)ethyl]imidazole-4-carboxylate is sourced from PubChem (CID 171390277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).