About 3-(2-propan-2-ylimidazol-1-yl)propan-1-amine;dihydrobromide
3-(2-propan-2-ylimidazol-1-yl)propan-1-amine;dihydrobromide (PubChem CID 17139034) has the molecular formula C9H19Br2N3
and a molecular weight of 329.08 g/mol. Its IUPAC name is 3-(2-propan-2-ylimidazol-1-yl)propan-1-amine;dihydrobromide.
Molecular Properties
| Compound Name | 3-(2-propan-2-ylimidazol-1-yl)propan-1-amine;dihydrobromide |
| PubChem CID | 17139034 |
| Molecular Formula | C9H19Br2N3 |
| Molecular Weight | 329.08 g/mol |
| Exact Mass | 326.99 |
| IUPAC Name | 3-(2-propan-2-ylimidazol-1-yl)propan-1-amine;dihydrobromide |
| SMILES | Br.Br.CC(C)c1nccn1CCCN |
| InChI | InChI=1S/C9H17N3.2BrH/c1-8(2)9-11-5-7-12(9)6-3-4-10;;/h5,7-8H,3-4,6,10H2,1-2H3;2*1H |
| InChIKey | LJWVMXCYCBOKCG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.08 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-propan-2-ylimidazol-1-yl)propan-1-amine;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-propan-2-ylimidazol-1-yl)propan-1-amine;dihydrobromide?
The IUPAC name of 3-(2-propan-2-ylimidazol-1-yl)propan-1-amine;dihydrobromide (CID 17139034) is 3-(2-propan-2-ylimidazol-1-yl)propan-1-amine;dihydrobromide.
What is the SMILES notation for 3-(2-propan-2-ylimidazol-1-yl)propan-1-amine;dihydrobromide?
The canonical SMILES for 3-(2-propan-2-ylimidazol-1-yl)propan-1-amine;dihydrobromide is Br.Br.CC(C)c1nccn1CCCN.
What is the InChIKey of 3-(2-propan-2-ylimidazol-1-yl)propan-1-amine;dihydrobromide?
The InChIKey is LJWVMXCYCBOKCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3.2BrH/c1-8(2)9-11-5-7-12(9)6-3-4-10;;/h5,7-8H,3-4,6,10H2,1-2H3;2*1H.
What are the key properties of 3-(2-propan-2-ylimidazol-1-yl)propan-1-amine;dihydrobromide?
3-(2-propan-2-ylimidazol-1-yl)propan-1-amine;dihydrobromide has a molecular weight of 329.08 g/mol, XLogP of 2.51, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-propan-2-ylimidazol-1-yl)propan-1-amine;dihydrobromide is sourced from PubChem (CID 17139034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).