C8H10ClF2N3O — CID 171390658
3-[[5-chloro-6-(difluoromethyl)pyrimidin-4-yl]amino]propan-1-ol (PubChem CID 171390658) has the molecular formula C8H10ClF2N3O and a molecular weight of 237.64 g/mol. Its IUPAC name is 3-[[5-chloro-6-(difluoromethyl)pyrimidin-4-yl]amino]propan-1-ol.
| Compound Name | 3-[[5-chloro-6-(difluoromethyl)pyrimidin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 171390658 |
| Molecular Formula | C8H10ClF2N3O |
| Molecular Weight | 237.64 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 3-[[5-chloro-6-(difluoromethyl)pyrimidin-4-yl]amino]propan-1-ol |
| SMILES | OCCCNc1ncnc(C(F)F)c1Cl |
| InChI | InChI=1S/C8H10ClF2N3O/c9-5-6(7(10)11)13-4-14-8(5)12-2-1-3-15/h4,7,15H,1-3H2,(H,12,13,14) |
| InChIKey | BRUCOQCPVCLWMS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.64 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|