About (NE)-N-(2,2-diaminoethylidene)thiomorpholine-4-carboximidamide;hydrochloride
(NE)-N-(2,2-diaminoethylidene)thiomorpholine-4-carboximidamide;hydrochloride (PubChem CID 17139082) has the molecular formula C7H16ClN5S
and a molecular weight of 237.76 g/mol. Its IUPAC name is (NE)-N-(2,2-diaminoethylidene)thiomorpholine-4-carboximidamide;hydrochloride.
Molecular Properties
| Compound Name | (NE)-N-(2,2-diaminoethylidene)thiomorpholine-4-carboximidamide;hydrochloride |
| PubChem CID | 17139082 |
| Molecular Formula | C7H16ClN5S |
| Molecular Weight | 237.76 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | (NE)-N-(2,2-diaminoethylidene)thiomorpholine-4-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N=C\C(N)N)N1CCSCC1 |
| InChI | InChI=1S/C7H15N5S.ClH/c8-6(9)5-11-7(10)12-1-3-13-4-2-12;/h5-6,10H,1-4,8-9H2;1H/b10-7+,11-5+; |
| InChIKey | CEJANAKUWFKBGF-CHFYDQFWSA-N |
| XLogP | -0.29 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.76 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-(2,2-diaminoethylidene)thiomorpholine-4-carboximidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-(2,2-diaminoethylidene)thiomorpholine-4-carboximidamide;hydrochloride?
The IUPAC name of (NE)-N-(2,2-diaminoethylidene)thiomorpholine-4-carboximidamide;hydrochloride (CID 17139082) is (NE)-N-(2,2-diaminoethylidene)thiomorpholine-4-carboximidamide;hydrochloride.
What is the SMILES notation for (NE)-N-(2,2-diaminoethylidene)thiomorpholine-4-carboximidamide;hydrochloride?
The canonical SMILES for (NE)-N-(2,2-diaminoethylidene)thiomorpholine-4-carboximidamide;hydrochloride is Cl.[H]/N=C(\N=C\C(N)N)N1CCSCC1.
What is the InChIKey of (NE)-N-(2,2-diaminoethylidene)thiomorpholine-4-carboximidamide;hydrochloride?
The InChIKey is CEJANAKUWFKBGF-CHFYDQFWSA-N. The full InChI is InChI=1S/C7H15N5S.ClH/c8-6(9)5-11-7(10)12-1-3-13-4-2-12;/h5-6,10H,1-4,8-9H2;1H/b10-7+,11-5+;.
What are the key properties of (NE)-N-(2,2-diaminoethylidene)thiomorpholine-4-carboximidamide;hydrochloride?
(NE)-N-(2,2-diaminoethylidene)thiomorpholine-4-carboximidamide;hydrochloride has a molecular weight of 237.76 g/mol, XLogP of -0.29, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-(2,2-diaminoethylidene)thiomorpholine-4-carboximidamide;hydrochloride is sourced from PubChem (CID 17139082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).