About ethyl 5-acetyl-1,3-dibenzyl-4,6-dihydropyrimidin-1-ium-5-carboxylate nitrate
ethyl 5-acetyl-1,3-dibenzyl-4,6-dihydropyrimidin-1-ium-5-carboxylate nitrate (PubChem CID 171390870) has the molecular formula C23H27N3O6
and a molecular weight of 441.48 g/mol. Its IUPAC name is ethyl 5-acetyl-1,3-dibenzyl-4,6-dihydropyrimidin-1-ium-5-carboxylate nitrate.
Molecular Properties
| Compound Name | ethyl 5-acetyl-1,3-dibenzyl-4,6-dihydropyrimidin-1-ium-5-carboxylate nitrate |
| PubChem CID | 171390870 |
| Molecular Formula | C23H27N3O6 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | ethyl 5-acetyl-1,3-dibenzyl-4,6-dihydropyrimidin-1-ium-5-carboxylate nitrate |
| SMILES | CCOC(=O)C1(C(C)=O)CN(Cc2ccccc2)C=[N+](Cc2ccccc2)C1.O=[N+]([O-])[O-] |
| InChI | InChI=1S/C23H27N2O3.NO3/c1-3-28-22(27)23(19(2)26)16-24(14-20-10-6-4-7-11-20)18-25(17-23)15-21-12-8-5-9-13-21;2-1(3)4/h4-13,18H,3,14-17H2,1-2H3;/q+1;-1 |
| InChIKey | CWUSVTNAZJWPEB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-acetyl-1,3-dibenzyl-4,6-dihydropyrimidin-1-ium-5-carboxylate nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-acetyl-1,3-dibenzyl-4,6-dihydropyrimidin-1-ium-5-carboxylate nitrate?
The IUPAC name of ethyl 5-acetyl-1,3-dibenzyl-4,6-dihydropyrimidin-1-ium-5-carboxylate nitrate (CID 171390870) is ethyl 5-acetyl-1,3-dibenzyl-4,6-dihydropyrimidin-1-ium-5-carboxylate nitrate.
What is the SMILES notation for ethyl 5-acetyl-1,3-dibenzyl-4,6-dihydropyrimidin-1-ium-5-carboxylate nitrate?
The canonical SMILES for ethyl 5-acetyl-1,3-dibenzyl-4,6-dihydropyrimidin-1-ium-5-carboxylate nitrate is CCOC(=O)C1(C(C)=O)CN(Cc2ccccc2)C=[N+](Cc2ccccc2)C1.O=[N+]([O-])[O-].
What is the InChIKey of ethyl 5-acetyl-1,3-dibenzyl-4,6-dihydropyrimidin-1-ium-5-carboxylate nitrate?
The InChIKey is CWUSVTNAZJWPEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N2O3.NO3/c1-3-28-22(27)23(19(2)26)16-24(14-20-10-6-4-7-11-20)18-25(17-23)15-21-12-8-5-9-13-21;2-1(3)4/h4-13,18H,3,14-17H2,1-2H3;/q+1;-1.
What are the key properties of ethyl 5-acetyl-1,3-dibenzyl-4,6-dihydropyrimidin-1-ium-5-carboxylate nitrate?
ethyl 5-acetyl-1,3-dibenzyl-4,6-dihydropyrimidin-1-ium-5-carboxylate nitrate has a molecular weight of 441.48 g/mol, XLogP of 2.64, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-acetyl-1,3-dibenzyl-4,6-dihydropyrimidin-1-ium-5-carboxylate nitrate is sourced from PubChem (CID 171390870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).