About 5-amino-2-(2,4-difluorophenyl)phenol
5-amino-2-(2,4-difluorophenyl)phenol (PubChem CID 171391098) has the molecular formula C12H9F2NO
and a molecular weight of 221.21 g/mol. Its IUPAC name is 5-amino-2-(2,4-difluorophenyl)phenol.
Molecular Properties
| Compound Name | 5-amino-2-(2,4-difluorophenyl)phenol |
| PubChem CID | 171391098 |
| Molecular Formula | C12H9F2NO |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 5-amino-2-(2,4-difluorophenyl)phenol |
| SMILES | Nc1ccc(-c2ccc(F)cc2F)c(O)c1 |
| InChI | InChI=1S/C12H9F2NO/c13-7-1-3-9(11(14)5-7)10-4-2-8(15)6-12(10)16/h1-6,16H,15H2 |
| InChIKey | NCHPCNXBTNSBCP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2-(2,4-difluorophenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-(2,4-difluorophenyl)phenol?
The IUPAC name of 5-amino-2-(2,4-difluorophenyl)phenol (CID 171391098) is 5-amino-2-(2,4-difluorophenyl)phenol.
What is the SMILES notation for 5-amino-2-(2,4-difluorophenyl)phenol?
The canonical SMILES for 5-amino-2-(2,4-difluorophenyl)phenol is Nc1ccc(-c2ccc(F)cc2F)c(O)c1.
What is the InChIKey of 5-amino-2-(2,4-difluorophenyl)phenol?
The InChIKey is NCHPCNXBTNSBCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9F2NO/c13-7-1-3-9(11(14)5-7)10-4-2-8(15)6-12(10)16/h1-6,16H,15H2.
What are the key properties of 5-amino-2-(2,4-difluorophenyl)phenol?
5-amino-2-(2,4-difluorophenyl)phenol has a molecular weight of 221.21 g/mol, XLogP of 2.92, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-(2,4-difluorophenyl)phenol is sourced from PubChem (CID 171391098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).