C10H17ClN2O4S3 — CID 171391656
(4S,6S)-4,5,5-trideuterio-4-(ethylamino)-6-methyl-7,7-dioxo-6H-thieno[2,3-b]thiopyran-2-sulfonamide;hydrochloride (PubChem CID 171391656) has the molecular formula C10H17ClN2O4S3 and a molecular weight of 363.93 g/mol. Its IUPAC name is (4S,6S)-4,5,5-trideuterio-4-(ethylamino)-6-methyl-7,7-dioxo-6H-thieno[2,3-b]thiopyran-2-sulfonamide;hydrochloride.
| Compound Name | (4S,6S)-4,5,5-trideuterio-4-(ethylamino)-6-methyl-7,7-dioxo-6H-thieno[2,3-b]thiopyran-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 171391656 |
| Molecular Formula | C10H17ClN2O4S3 |
| Molecular Weight | 363.93 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | (4S,6S)-4,5,5-trideuterio-4-(ethylamino)-6-methyl-7,7-dioxo-6H-thieno[2,3-b]thiopyran-2-sulfonamide;hydrochloride |
| SMILES | Cl.[2H]C1([2H])[C@H](C)S(=O)(=O)c2sc(S(N)(=O)=O)cc2[C@@]1([2H])NCC |
| InChI | InChI=1S/C10H16N2O4S3.ClH/c1-3-12-8-4-6(2)18(13,14)10-7(8)5-9(17-10)19(11,15)16;/h5-6,8,12H,3-4H2,1-2H3,(H2,11,15,16);1H/t6-,8-;/m0./s1/i4D2,8D; |
| InChIKey | OSRUSFPMRGDLAG-MLFPSNPGSA-N |
| XLogP | 1.03 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.93 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |