C30H48O5 — CID 171392384
(1S,2R,3R,5R,7S,10S,11R,14R,15S)-15-[(3S,5R)-5-[(2S)-3,3-dimethyloxiran-2-yl]-2-hydroxyoxolan-3-yl]-2,6,6,10-tetramethylpentacyclo[12.3.1.01,14.02,11.05,10]octadecane-3,7-diol (PubChem CID 171392384) has the molecular formula C30H48O5 and a molecular weight of 488.71 g/mol. Its IUPAC name is (1S,2R,3R,5R,7S,10S,11R,14R,15S)-15-[(3S,5R)-5-[(2S)-3,3-dimethyloxiran-2-yl]-2-hydroxyoxolan-3-yl]-2,6,6,10-tetramethylpentacyclo[12.3.1.01,14.02,11.05,10]octadecane-3,7-diol.
| Compound Name | (1S,2R,3R,5R,7S,10S,11R,14R,15S)-15-[(3S,5R)-5-[(2S)-3,3-dimethyloxiran-2-yl]-2-hydroxyoxolan-3-yl]-2,6,6,10-tetramethylpentacyclo[12.3.1.01,14.02,11.05,10]octadecane-3,7-diol |
|---|---|
| PubChem CID | 171392384 |
| Molecular Formula | C30H48O5 |
| Molecular Weight | 488.71 g/mol |
| Exact Mass | 488.35 |
| IUPAC Name | (1S,2R,3R,5R,7S,10S,11R,14R,15S)-15-[(3S,5R)-5-[(2S)-3,3-dimethyloxiran-2-yl]-2-hydroxyoxolan-3-yl]-2,6,6,10-tetramethylpentacyclo[12.3.1.01,14.02,11.05,10]octadecane-3,7-diol |
| SMILES | CC1(C)O[C@H]1[C@H]1C[C@@H]([C@@H]2CC[C@]34C[C@]23CC[C@@H]2[C@@]3(C)CC[C@H](O)C(C)(C)[C@@H]3C[C@@H](O)[C@]24C)C(O)O1 |
| InChI | InChI=1S/C30H48O5/c1-25(2)20-14-22(32)28(6)19(27(20,5)10-9-21(25)31)8-11-29-15-30(28,29)12-7-17(29)16-13-18(34-24(16)33)23-26(3,4)35-23/h16-24,31-33H,7-15H2,1-6H3/t16-,17-,18+,19+,20-,21-,22+,23-,24?,27+,28-,29+,30+/m0/s1 |
| InChIKey | QMNOQUXZKUEYBM-QEMCERIBSA-N |
| XLogP | 4.66 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.71 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|