C27H36O — CID 171392479
(1R)-3,5,5-trimethyl-4-[(3E,5E,7E,9E,11E,13E)-3,7,12-trimethylpentadeca-3,5,7,9,11,13-hexaen-1-ynyl]cyclohex-3-en-1-ol (PubChem CID 171392479) has the molecular formula C27H36O and a molecular weight of 376.58 g/mol. Its IUPAC name is (1R)-3,5,5-trimethyl-4-[(3E,5E,7E,9E,11E,13E)-3,7,12-trimethylpentadeca-3,5,7,9,11,13-hexaen-1-ynyl]cyclohex-3-en-1-ol.
| Compound Name | (1R)-3,5,5-trimethyl-4-[(3E,5E,7E,9E,11E,13E)-3,7,12-trimethylpentadeca-3,5,7,9,11,13-hexaen-1-ynyl]cyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 171392479 |
| Molecular Formula | C27H36O |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | (1R)-3,5,5-trimethyl-4-[(3E,5E,7E,9E,11E,13E)-3,7,12-trimethylpentadeca-3,5,7,9,11,13-hexaen-1-ynyl]cyclohex-3-en-1-ol |
| SMILES | C/C=C/C(C)=C/C=C/C=C(C)/C=C/C=C(\C)C#CC1=C(C)C[C@@H](O)CC1(C)C |
| InChI | InChI=1S/C27H36O/c1-8-12-21(2)13-9-10-14-22(3)15-11-16-23(4)17-18-26-24(5)19-25(28)20-27(26,6)7/h8-16,25,28H,19-20H2,1-7H3/b10-9+,12-8+,15-11+,21-13+,22-14+,23-16+/t25-/m1/s1 |
| InChIKey | QHWMMXNJQOTROL-NMZMQQKQSA-N |
| XLogP | 7.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|