C12H26N2O3 — CID 171392759
(3R,4R,5R)-1-(6-aminohexyl)-5-(hydroxymethyl)piperidine-3,4-diol (PubChem CID 171392759) has the molecular formula C12H26N2O3 and a molecular weight of 246.35 g/mol. Its IUPAC name is (3R,4R,5R)-1-(6-aminohexyl)-5-(hydroxymethyl)piperidine-3,4-diol.
| Compound Name | (3R,4R,5R)-1-(6-aminohexyl)-5-(hydroxymethyl)piperidine-3,4-diol |
|---|---|
| PubChem CID | 171392759 |
| Molecular Formula | C12H26N2O3 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | (3R,4R,5R)-1-(6-aminohexyl)-5-(hydroxymethyl)piperidine-3,4-diol |
| SMILES | NCCCCCCN1C[C@H](CO)[C@@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C12H26N2O3/c13-5-3-1-2-4-6-14-7-10(9-15)12(17)11(16)8-14/h10-12,15-17H,1-9,13H2/t10-,11-,12-/m1/s1 |
| InChIKey | KGWBQKXDNCIMGO-IJLUTSLNSA-N |
| XLogP | -0.85 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|