C22H22Cl2F12Zr — CID 171392890
bis(1,5-bis(3,3,3-trifluoropropyl)cyclopenta-1,3-diene);dichlorozirconium(2+) (PubChem CID 171392890) has the molecular formula C22H22Cl2F12Zr and a molecular weight of 676.52 g/mol. Its IUPAC name is bis(1,5-bis(3,3,3-trifluoropropyl)cyclopenta-1,3-diene);dichlorozirconium(2+).
| Compound Name | bis(1,5-bis(3,3,3-trifluoropropyl)cyclopenta-1,3-diene);dichlorozirconium(2+) |
|---|---|
| PubChem CID | 171392890 |
| Molecular Formula | C22H22Cl2F12Zr |
| Molecular Weight | 676.52 g/mol |
| Exact Mass | 674.00 |
| IUPAC Name | bis(1,5-bis(3,3,3-trifluoropropyl)cyclopenta-1,3-diene);dichlorozirconium(2+) |
| SMILES | Cl[Zr+2]Cl.FC(F)(F)CCc1ccc[c-]1CCC(F)(F)F.FC(F)(F)CCc1ccc[c-]1CCC(F)(F)F |
| InChI | InChI=1S/2C11H11F6.2ClH.Zr/c2*12-10(13,14)6-4-8-2-1-3-9(8)5-7-11(15,16)17;;;/h2*1-3H,4-7H2;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | OJVSBHBNGJONEW-UHFFFAOYSA-L |
| XLogP | 10.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.52 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|