C14H28NO8P — CID 171393582
[(2R)-2-acetyloxy-3-[2-aminoethoxy(hydroxy)phosphoryl]oxypropyl] heptanoate (PubChem CID 171393582) has the molecular formula C14H28NO8P and a molecular weight of 369.35 g/mol. Its IUPAC name is [(2R)-2-acetyloxy-3-[2-aminoethoxy(hydroxy)phosphoryl]oxypropyl] heptanoate.
| Compound Name | [(2R)-2-acetyloxy-3-[2-aminoethoxy(hydroxy)phosphoryl]oxypropyl] heptanoate |
|---|---|
| PubChem CID | 171393582 |
| Molecular Formula | C14H28NO8P |
| Molecular Weight | 369.35 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | [(2R)-2-acetyloxy-3-[2-aminoethoxy(hydroxy)phosphoryl]oxypropyl] heptanoate |
| SMILES | CCCCCCC(=O)OC[C@H](COP(=O)(O)OCCN)OC(C)=O |
| InChI | InChI=1S/C14H28NO8P/c1-3-4-5-6-7-14(17)20-10-13(23-12(2)16)11-22-24(18,19)21-9-8-15/h13H,3-11,15H2,1-2H3,(H,18,19)/t13-/m1/s1 |
| InChIKey | UFNRSSIXIAMZDV-CYBMUJFWSA-N |
| XLogP | 1.52 |
| TPSA | 134.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|