About methanesulfonate;tripropylazanium
methanesulfonate;tripropylazanium (PubChem CID 171393722) has the molecular formula C10H25NO3S
and a molecular weight of 239.38 g/mol. Its IUPAC name is methanesulfonate;tripropylazanium.
Molecular Properties
| Compound Name | methanesulfonate;tripropylazanium |
| PubChem CID | 171393722 |
| Molecular Formula | C10H25NO3S |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | methanesulfonate;tripropylazanium |
| SMILES | CCC[NH+](CCC)CCC.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C9H21N.CH4O3S/c1-4-7-10(8-5-2)9-6-3;1-5(2,3)4/h4-9H2,1-3H3;1H3,(H,2,3,4) |
| InChIKey | DHBZBLDPXBXXMH-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 61.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonate;tripropylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonate;tripropylazanium?
The IUPAC name of methanesulfonate;tripropylazanium (CID 171393722) is methanesulfonate;tripropylazanium.
What is the SMILES notation for methanesulfonate;tripropylazanium?
The canonical SMILES for methanesulfonate;tripropylazanium is CCC[NH+](CCC)CCC.CS(=O)(=O)[O-].
What is the InChIKey of methanesulfonate;tripropylazanium?
The InChIKey is DHBZBLDPXBXXMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N.CH4O3S/c1-4-7-10(8-5-2)9-6-3;1-5(2,3)4/h4-9H2,1-3H3;1H3,(H,2,3,4).
What are the key properties of methanesulfonate;tripropylazanium?
methanesulfonate;tripropylazanium has a molecular weight of 239.38 g/mol, XLogP of 0.26, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonate;tripropylazanium is sourced from PubChem (CID 171393722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).