C12H8F2O — CID 171394624
2,3,5,6-tetradeuterio-4-(2,4-difluorophenyl)phenol (PubChem CID 171394624) has the molecular formula C12H8F2O and a molecular weight of 210.22 g/mol. Its IUPAC name is 2,3,5,6-tetradeuterio-4-(2,4-difluorophenyl)phenol.
| Compound Name | 2,3,5,6-tetradeuterio-4-(2,4-difluorophenyl)phenol |
|---|---|
| PubChem CID | 171394624 |
| Molecular Formula | C12H8F2O |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 2,3,5,6-tetradeuterio-4-(2,4-difluorophenyl)phenol |
| SMILES | [2H]c1c([2H])c(-c2ccc(F)cc2F)c([2H])c([2H])c1O |
| InChI | InChI=1S/C12H8F2O/c13-9-3-6-11(12(14)7-9)8-1-4-10(15)5-2-8/h1-7,15H/i1D,2D,4D,5D |
| InChIKey | ASOVDRYKVVVCIA-GYABSUSNSA-N |
| XLogP | 3.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |