C18H24N2O3 — CID 171394902
[(6aR,9R,10aS)-4-(hydroxymethyl)-7-methyl-10a-(trideuteriomethoxy)-6a,8,9,10-tetrahydro-6H-indolo[4,3-fg]quinolin-9-yl]methanol (PubChem CID 171394902) has the molecular formula C18H24N2O3 and a molecular weight of 319.42 g/mol. Its IUPAC name is [(6aR,9R,10aS)-4-(hydroxymethyl)-7-methyl-10a-(trideuteriomethoxy)-6a,8,9,10-tetrahydro-6H-indolo[4,3-fg]quinolin-9-yl]methanol.
| Compound Name | [(6aR,9R,10aS)-4-(hydroxymethyl)-7-methyl-10a-(trideuteriomethoxy)-6a,8,9,10-tetrahydro-6H-indolo[4,3-fg]quinolin-9-yl]methanol |
|---|---|
| PubChem CID | 171394902 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | [(6aR,9R,10aS)-4-(hydroxymethyl)-7-methyl-10a-(trideuteriomethoxy)-6a,8,9,10-tetrahydro-6H-indolo[4,3-fg]quinolin-9-yl]methanol |
| SMILES | [2H]C([2H])([2H])O[C@]12C[C@@H](CO)CN(C)[C@@H]1Cc1cn(CO)c3cccc2c13 |
| InChI | InChI=1S/C18H24N2O3/c1-19-8-12(10-21)7-18(23-2)14-4-3-5-15-17(14)13(6-16(18)19)9-20(15)11-22/h3-5,9,12,16,21-22H,6-8,10-11H2,1-2H3/t12-,16-,18+/m1/s1/i2D3 |
| InChIKey | HRGNTZRYCNRYJR-KIIQNDOJSA-N |
| XLogP | 1.30 |
| TPSA | 57.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|