C18H21F3N6O2 — CID 171395013
5-[2,6-bis(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)pyrimidin-4-yl]-4-(trifluoromethyl)pyridin-2-amine (PubChem CID 171395013) has the molecular formula C18H21F3N6O2 and a molecular weight of 426.50 g/mol. Its IUPAC name is 5-[2,6-bis(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)pyrimidin-4-yl]-4-(trifluoromethyl)pyridin-2-amine.
| Compound Name | 5-[2,6-bis(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)pyrimidin-4-yl]-4-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 171395013 |
| Molecular Formula | C18H21F3N6O2 |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | 5-[2,6-bis(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)pyrimidin-4-yl]-4-(trifluoromethyl)pyridin-2-amine |
| SMILES | [2H]C1([2H])OC([2H])([2H])C([2H])([2H])N(c2cc(-c3cnc(N)cc3C(F)(F)F)nc(N3C([2H])([2H])C([2H])([2H])OC([2H])([2H])C3([2H])[2H])n2)C1([2H])[2H] |
| InChI | InChI=1S/C18H21F3N6O2/c19-18(20,21)13-9-15(22)23-11-12(13)14-10-16(26-1-5-28-6-2-26)25-17(24-14)27-3-7-29-8-4-27/h9-11H,1-8H2,(H2,22,23)/i1D2,2D2,3D2,4D2,5D2,6D2,7D2,8D2 |
| InChIKey | CWHUFRVAEUJCEF-SADLKCKLSA-N |
| XLogP | 1.81 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |