C28H32F3N9O3S — CID 171395454
2-ethyl-6-methyl-N-[[4-[4-[7-(trifluoromethylsulfonyl)-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-2-yl]piperidin-1-yl]phenyl]methyl]imidazo[1,2-a]pyrimidine-3-carboxamide (PubChem CID 171395454) has the molecular formula C28H32F3N9O3S and a molecular weight of 631.69 g/mol. Its IUPAC name is 2-ethyl-6-methyl-N-[[4-[4-[7-(trifluoromethylsulfonyl)-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-2-yl]piperidin-1-yl]phenyl]methyl]imidazo[1,2-a]pyrimidine-3-carboxamide.
| Compound Name | 2-ethyl-6-methyl-N-[[4-[4-[7-(trifluoromethylsulfonyl)-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-2-yl]piperidin-1-yl]phenyl]methyl]imidazo[1,2-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 171395454 |
| Molecular Formula | C28H32F3N9O3S |
| Molecular Weight | 631.69 g/mol |
| Exact Mass | 631.23 |
| IUPAC Name | 2-ethyl-6-methyl-N-[[4-[4-[7-(trifluoromethylsulfonyl)-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazin-2-yl]piperidin-1-yl]phenyl]methyl]imidazo[1,2-a]pyrimidine-3-carboxamide |
| SMILES | CCc1nc2ncc(C)cn2c1C(=O)NCc1ccc(N2CCC(c3nc4n(n3)CCN(S(=O)(=O)C(F)(F)F)C4)CC2)cc1 |
| InChI | InChI=1S/C28H32F3N9O3S/c1-3-22-24(39-16-18(2)14-33-27(39)34-22)26(41)32-15-19-4-6-21(7-5-19)37-10-8-20(9-11-37)25-35-23-17-38(12-13-40(23)36-25)44(42,43)28(29,30)31/h4-7,14,16,20H,3,8-13,15,17H2,1-2H3,(H,32,41) |
| InChIKey | ZLQFEKFMWQQEOI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 130.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.69 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|