About 4-(4-chlorophenyl)-2,6-bis(1H-indol-3-yl)pyridine-3-carbonitrile
4-(4-chlorophenyl)-2,6-bis(1H-indol-3-yl)pyridine-3-carbonitrile (PubChem CID 171396100) has the molecular formula C28H17ClN4
and a molecular weight of 444.93 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2,6-bis(1H-indol-3-yl)pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 4-(4-chlorophenyl)-2,6-bis(1H-indol-3-yl)pyridine-3-carbonitrile |
| PubChem CID | 171396100 |
| Molecular Formula | C28H17ClN4 |
| Molecular Weight | 444.93 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | 4-(4-chlorophenyl)-2,6-bis(1H-indol-3-yl)pyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(Cl)cc2)cc(-c2c[nH]c3ccccc23)nc1-c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C28H17ClN4/c29-18-11-9-17(10-12-18)21-13-27(23-15-31-25-7-3-1-5-19(23)25)33-28(22(21)14-30)24-16-32-26-8-4-2-6-20(24)26/h1-13,15-16,31-32H |
| InChIKey | OPJICSFBUFJPOM-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.93 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-chlorophenyl)-2,6-bis(1H-indol-3-yl)pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorophenyl)-2,6-bis(1H-indol-3-yl)pyridine-3-carbonitrile?
The IUPAC name of 4-(4-chlorophenyl)-2,6-bis(1H-indol-3-yl)pyridine-3-carbonitrile (CID 171396100) is 4-(4-chlorophenyl)-2,6-bis(1H-indol-3-yl)pyridine-3-carbonitrile.
What is the SMILES notation for 4-(4-chlorophenyl)-2,6-bis(1H-indol-3-yl)pyridine-3-carbonitrile?
The canonical SMILES for 4-(4-chlorophenyl)-2,6-bis(1H-indol-3-yl)pyridine-3-carbonitrile is N#Cc1c(-c2ccc(Cl)cc2)cc(-c2c[nH]c3ccccc23)nc1-c1c[nH]c2ccccc12.
What is the InChIKey of 4-(4-chlorophenyl)-2,6-bis(1H-indol-3-yl)pyridine-3-carbonitrile?
The InChIKey is OPJICSFBUFJPOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H17ClN4/c29-18-11-9-17(10-12-18)21-13-27(23-15-31-25-7-3-1-5-19(23)25)33-28(22(21)14-30)24-16-32-26-8-4-2-6-20(24)26/h1-13,15-16,31-32H.
What are the key properties of 4-(4-chlorophenyl)-2,6-bis(1H-indol-3-yl)pyridine-3-carbonitrile?
4-(4-chlorophenyl)-2,6-bis(1H-indol-3-yl)pyridine-3-carbonitrile has a molecular weight of 444.93 g/mol, XLogP of 7.57, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorophenyl)-2,6-bis(1H-indol-3-yl)pyridine-3-carbonitrile is sourced from PubChem (CID 171396100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).