C15H23NO — CID 171396612
2-(4-methylpent-3-enyl)-1,6,7,8,9,9a-hexahydroquinolizin-4-one (PubChem CID 171396612) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 2-(4-methylpent-3-enyl)-1,6,7,8,9,9a-hexahydroquinolizin-4-one.
| Compound Name | 2-(4-methylpent-3-enyl)-1,6,7,8,9,9a-hexahydroquinolizin-4-one |
|---|---|
| PubChem CID | 171396612 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 2-(4-methylpent-3-enyl)-1,6,7,8,9,9a-hexahydroquinolizin-4-one |
| SMILES | CC(C)=CCCC1=CC(=O)N2CCCCC2C1 |
| InChI | InChI=1S/C15H23NO/c1-12(2)6-5-7-13-10-14-8-3-4-9-16(14)15(17)11-13/h6,11,14H,3-5,7-10H2,1-2H3 |
| InChIKey | IUZZPRIUZNLIAN-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|