About (2Z)-3-(2-hydroxyphenyl)-2-(5-nitropyrimidin-2-yl)imino-1,3-thiazolidin-4-one
(2Z)-3-(2-hydroxyphenyl)-2-(5-nitropyrimidin-2-yl)imino-1,3-thiazolidin-4-one (PubChem CID 171396668) has the molecular formula C13H9N5O4S
and a molecular weight of 331.31 g/mol. Its IUPAC name is (2Z)-3-(2-hydroxyphenyl)-2-(5-nitropyrimidin-2-yl)imino-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | (2Z)-3-(2-hydroxyphenyl)-2-(5-nitropyrimidin-2-yl)imino-1,3-thiazolidin-4-one |
| PubChem CID | 171396668 |
| Molecular Formula | C13H9N5O4S |
| Molecular Weight | 331.31 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | (2Z)-3-(2-hydroxyphenyl)-2-(5-nitropyrimidin-2-yl)imino-1,3-thiazolidin-4-one |
| SMILES | O=C1CS/C(=N\c2ncc([N+](=O)[O-])cn2)N1c1ccccc1O |
| InChI | InChI=1S/C13H9N5O4S/c19-10-4-2-1-3-9(10)17-11(20)7-23-13(17)16-12-14-5-8(6-15-12)18(21)22/h1-6,19H,7H2/b16-13- |
| InChIKey | BQIXHNHEKKGSEX-SSZFMOIBSA-N |
| XLogP | 1.86 |
| TPSA | 121.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-3-(2-hydroxyphenyl)-2-(5-nitropyrimidin-2-yl)imino-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-3-(2-hydroxyphenyl)-2-(5-nitropyrimidin-2-yl)imino-1,3-thiazolidin-4-one?
The IUPAC name of (2Z)-3-(2-hydroxyphenyl)-2-(5-nitropyrimidin-2-yl)imino-1,3-thiazolidin-4-one (CID 171396668) is (2Z)-3-(2-hydroxyphenyl)-2-(5-nitropyrimidin-2-yl)imino-1,3-thiazolidin-4-one.
What is the SMILES notation for (2Z)-3-(2-hydroxyphenyl)-2-(5-nitropyrimidin-2-yl)imino-1,3-thiazolidin-4-one?
The canonical SMILES for (2Z)-3-(2-hydroxyphenyl)-2-(5-nitropyrimidin-2-yl)imino-1,3-thiazolidin-4-one is O=C1CS/C(=N\c2ncc([N+](=O)[O-])cn2)N1c1ccccc1O.
What is the InChIKey of (2Z)-3-(2-hydroxyphenyl)-2-(5-nitropyrimidin-2-yl)imino-1,3-thiazolidin-4-one?
The InChIKey is BQIXHNHEKKGSEX-SSZFMOIBSA-N. The full InChI is InChI=1S/C13H9N5O4S/c19-10-4-2-1-3-9(10)17-11(20)7-23-13(17)16-12-14-5-8(6-15-12)18(21)22/h1-6,19H,7H2/b16-13-.
What are the key properties of (2Z)-3-(2-hydroxyphenyl)-2-(5-nitropyrimidin-2-yl)imino-1,3-thiazolidin-4-one?
(2Z)-3-(2-hydroxyphenyl)-2-(5-nitropyrimidin-2-yl)imino-1,3-thiazolidin-4-one has a molecular weight of 331.31 g/mol, XLogP of 1.86, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-3-(2-hydroxyphenyl)-2-(5-nitropyrimidin-2-yl)imino-1,3-thiazolidin-4-one is sourced from PubChem (CID 171396668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).