C18H34N6O7 — CID 171396706
2-[(2-aminoacetyl)amino]-N,N'-bis[2-(2-hydroxypropanoylamino)ethyl]hexanediamide (PubChem CID 171396706) has the molecular formula C18H34N6O7 and a molecular weight of 446.51 g/mol. Its IUPAC name is 2-[(2-aminoacetyl)amino]-N,N'-bis[2-(2-hydroxypropanoylamino)ethyl]hexanediamide.
| Compound Name | 2-[(2-aminoacetyl)amino]-N,N'-bis[2-(2-hydroxypropanoylamino)ethyl]hexanediamide |
|---|---|
| PubChem CID | 171396706 |
| Molecular Formula | C18H34N6O7 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | 2-[(2-aminoacetyl)amino]-N,N'-bis[2-(2-hydroxypropanoylamino)ethyl]hexanediamide |
| SMILES | CC(O)C(=O)NCCNC(=O)CCCC(NC(=O)CN)C(=O)NCCNC(=O)C(C)O |
| InChI | InChI=1S/C18H34N6O7/c1-11(25)16(29)21-7-6-20-14(27)5-3-4-13(24-15(28)10-19)18(31)23-9-8-22-17(30)12(2)26/h11-13,25-26H,3-10,19H2,1-2H3,(H,20,27)(H,21,29)(H,22,30)(H,23,31)(H,24,28) |
| InChIKey | BQISKEDUZGCJNN-UHFFFAOYSA-N |
| XLogP | -4.17 |
| TPSA | 211.98 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | -4.17 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|