C20H34N4O5 — CID 171399219
2-[2-[2-[2-[2-(4-aminophenyl)ethyl-(carboxymethyl)amino]ethyl-methylamino]ethoxy]ethyl-methylamino]acetic acid (PubChem CID 171399219) has the molecular formula C20H34N4O5 and a molecular weight of 410.52 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-(4-aminophenyl)ethyl-(carboxymethyl)amino]ethyl-methylamino]ethoxy]ethyl-methylamino]acetic acid.
| Compound Name | 2-[2-[2-[2-[2-(4-aminophenyl)ethyl-(carboxymethyl)amino]ethyl-methylamino]ethoxy]ethyl-methylamino]acetic acid |
|---|---|
| PubChem CID | 171399219 |
| Molecular Formula | C20H34N4O5 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | 2-[2-[2-[2-[2-(4-aminophenyl)ethyl-(carboxymethyl)amino]ethyl-methylamino]ethoxy]ethyl-methylamino]acetic acid |
| SMILES | CN(CCOCCN(C)CC(=O)O)CCN(CCc1ccc(N)cc1)CC(=O)O |
| InChI | InChI=1S/C20H34N4O5/c1-22(11-13-29-14-12-23(2)15-19(25)26)9-10-24(16-20(27)28)8-7-17-3-5-18(21)6-4-17/h3-6H,7-16,21H2,1-2H3,(H,25,26)(H,27,28) |
| InChIKey | GHLUHEDRUYNWKF-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 119.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|