C12H21NO7 — CID 171399908
tert-butyl N-[(1S,2R,3R,4R,5S)-2,3-dihydroxy-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]carbamate (PubChem CID 171399908) has the molecular formula C12H21NO7 and a molecular weight of 291.30 g/mol. Its IUPAC name is tert-butyl N-[(1S,2R,3R,4R,5S)-2,3-dihydroxy-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,2R,3R,4R,5S)-2,3-dihydroxy-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]carbamate |
|---|---|
| PubChem CID | 171399908 |
| Molecular Formula | C12H21NO7 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | tert-butyl N-[(1S,2R,3R,4R,5S)-2,3-dihydroxy-1-(hydroxymethyl)-6,8-dioxabicyclo[3.2.1]octan-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1[C@H]2OC[C@](CO)(O2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H21NO7/c1-11(2,3)20-10(17)13-6-7(15)8(16)12(4-14)5-18-9(6)19-12/h6-9,14-16H,4-5H2,1-3H3,(H,13,17)/t6-,7-,8-,9+,12+/m1/s1 |
| InChIKey | KYUGGVSBDIXQOQ-YOESCMDLSA-N |
| XLogP | -1.28 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |