C13H19F3N4O4 — CID 171399919
(2R,3R,4R,5S)-2-(2-aminoethoxymethyl)-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol (PubChem CID 171399919) has the molecular formula C13H19F3N4O4 and a molecular weight of 352.31 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(2-aminoethoxymethyl)-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5S)-2-(2-aminoethoxymethyl)-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 171399919 |
| Molecular Formula | C13H19F3N4O4 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | (2R,3R,4R,5S)-2-(2-aminoethoxymethyl)-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol |
| SMILES | NCCOC[C@H]1OC[C@H](Nc2nccc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H19F3N4O4/c14-13(15,16)9-1-3-18-12(20-9)19-7-5-24-8(6-23-4-2-17)11(22)10(7)21/h1,3,7-8,10-11,21-22H,2,4-6,17H2,(H,18,19,20)/t7-,8+,10+,11-/m0/s1 |
| InChIKey | VYKKJHYDIYLGJP-URPMGSGRSA-N |
| XLogP | -0.63 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|