C13H15ClF3N3O5 — CID 171399920
(1S,2R,3R,4R,5S)-4-[[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]amino]-1-(methoxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol (PubChem CID 171399920) has the molecular formula C13H15ClF3N3O5 and a molecular weight of 385.73 g/mol. Its IUPAC name is (1S,2R,3R,4R,5S)-4-[[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]amino]-1-(methoxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol.
| Compound Name | (1S,2R,3R,4R,5S)-4-[[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]amino]-1-(methoxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
|---|---|
| PubChem CID | 171399920 |
| Molecular Formula | C13H15ClF3N3O5 |
| Molecular Weight | 385.73 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | (1S,2R,3R,4R,5S)-4-[[2-chloro-5-(trifluoromethyl)pyrimidin-4-yl]amino]-1-(methoxymethyl)-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
| SMILES | COC[C@@]12CO[C@@H](O1)[C@H](Nc1nc(Cl)ncc1C(F)(F)F)[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C13H15ClF3N3O5/c1-23-3-12-4-24-10(25-12)6(7(21)8(12)22)19-9-5(13(15,16)17)2-18-11(14)20-9/h2,6-8,10,21-22H,3-4H2,1H3,(H,18,19,20)/t6-,7-,8-,10+,12+/m1/s1 |
| InChIKey | YPPGQKGPYVFZIZ-OVQSLTOSSA-N |
| XLogP | 0.42 |
| TPSA | 105.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.73 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |